C12H17NO3S — CID 63924287
2-[[(1,1-dioxothian-3-yl)amino]methyl]phenol (PubChem CID 63924287) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-[[(1,1-dioxothian-3-yl)amino]methyl]phenol.
| Compound Name | 2-[[(1,1-dioxothian-3-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 63924287 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-[[(1,1-dioxothian-3-yl)amino]methyl]phenol |
| SMILES | O=S1(=O)CCCC(NCc2ccccc2O)C1 |
| InChI | InChI=1S/C12H17NO3S/c14-12-6-2-1-4-10(12)8-13-11-5-3-7-17(15,16)9-11/h1-2,4,6,11,13-14H,3,5,7-9H2 |
| InChIKey | YHUKLQCKSXWIEZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|