C12H17NO4S — CID 43190971
2-[[(1,1-dioxothiolan-3-yl)amino]methyl]-6-methoxyphenol (PubChem CID 43190971) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)amino]methyl]-6-methoxyphenol.
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)amino]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 43190971 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)amino]methyl]-6-methoxyphenol |
| SMILES | COc1cccc(CNC2CCS(=O)(=O)C2)c1O |
| InChI | InChI=1S/C12H17NO4S/c1-17-11-4-2-3-9(12(11)14)7-13-10-5-6-18(15,16)8-10/h2-4,10,13-14H,5-8H2,1H3 |
| InChIKey | DGDDSZPFZRSTIJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|