C12H17NO3S — CID 2449451
(3R)-N-[(4-methoxyphenyl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 2449451) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is (3R)-N-[(4-methoxyphenyl)methyl]-1,1-dioxothiolan-3-amine.
| Compound Name | (3R)-N-[(4-methoxyphenyl)methyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 2449451 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (3R)-N-[(4-methoxyphenyl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | COc1ccc(CN[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C12H17NO3S/c1-16-12-4-2-10(3-5-12)8-13-11-6-7-17(14,15)9-11/h2-5,11,13H,6-9H2,1H3/t11-/m1/s1 |
| InChIKey | ZCTMYCMIAGDAIV-LLVKDONJSA-N |
| XLogP | 0.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |