4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid

C12H15NO4S — CID 7121620

IUPAC4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid
SMILESO=C(O)c1ccc(CN[C@H]2CCS(=O)(=O)C2)cc1
InChIInChI=1S/C12H15NO4S/c14-12(15)10-3-1-9(2-4-10)7-13-11-5-6-18(16,17)8-11/h1-4,11,13H,5-8H2,(H,14,15)/t11-/m0/s1
InChIKeyMOJLIMGDPWKZAO-NSHDSACASA-N
MW269.32 g/mol
LogP0.66
Rot. Bonds4

About 4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid

4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid (PubChem CID 7121620) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid.

Molecular Properties

Compound Name4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid
PubChem CID7121620
Molecular FormulaC12H15NO4S
Molecular Weight269.32 g/mol
Exact Mass269.07
IUPAC Name4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid
SMILESO=C(O)c1ccc(CN[C@H]2CCS(=O)(=O)C2)cc1
InChIInChI=1S/C12H15NO4S/c14-12(15)10-3-1-9(2-4-10)7-13-11-5-6-18(16,17)8-11/h1-4,11,13H,5-8H2,(H,14,15)/t11-/m0/s1
InChIKeyMOJLIMGDPWKZAO-NSHDSACASA-N
XLogP0.66
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.32
LogP ≤ 50.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid?
The IUPAC name of 4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid (CID 7121620) is 4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid.
What is the SMILES notation for 4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid?
The canonical SMILES for 4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid is O=C(O)c1ccc(CN[C@H]2CCS(=O)(=O)C2)cc1.
What is the InChIKey of 4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid?
The InChIKey is MOJLIMGDPWKZAO-NSHDSACASA-N. The full InChI is InChI=1S/C12H15NO4S/c14-12(15)10-3-1-9(2-4-10)7-13-11-5-6-18(16,17)8-11/h1-4,11,13H,5-8H2,(H,14,15)/t11-/m0/s1.
What are the key properties of 4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid?
4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid has a molecular weight of 269.32 g/mol, XLogP of 0.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[(3S)-1,1-dioxothiolan-3-yl]amino]methyl]benzoic acid is sourced from PubChem (CID 7121620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).