4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid

C13H16FNO4S — CID 106700058

IUPAC4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid
SMILESO=C(O)c1ccc(CNC2CCCS(=O)(=O)C2)cc1F
InChIInChI=1S/C13H16FNO4S/c14-12-6-9(3-4-11(12)13(16)17)7-15-10-2-1-5-20(18,19)8-10/h3-4,6,10,15H,1-2,5,7-8H2,(H,16,17)
InChIKeyJYKFKPMHCWHNFI-UHFFFAOYSA-N
MW301.34 g/mol
LogP1.19
Rot. Bonds4

About 4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid

4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid (PubChem CID 106700058) has the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. Its IUPAC name is 4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid.

Molecular Properties

Compound Name4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid
PubChem CID106700058
Molecular FormulaC13H16FNO4S
Molecular Weight301.34 g/mol
Exact Mass301.08
IUPAC Name4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid
SMILESO=C(O)c1ccc(CNC2CCCS(=O)(=O)C2)cc1F
InChIInChI=1S/C13H16FNO4S/c14-12-6-9(3-4-11(12)13(16)17)7-15-10-2-1-5-20(18,19)8-10/h3-4,6,10,15H,1-2,5,7-8H2,(H,16,17)
InChIKeyJYKFKPMHCWHNFI-UHFFFAOYSA-N
XLogP1.19
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.34
LogP ≤ 51.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid?
The IUPAC name of 4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid (CID 106700058) is 4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid.
What is the SMILES notation for 4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid?
The canonical SMILES for 4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid is O=C(O)c1ccc(CNC2CCCS(=O)(=O)C2)cc1F.
What is the InChIKey of 4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid?
The InChIKey is JYKFKPMHCWHNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO4S/c14-12-6-9(3-4-11(12)13(16)17)7-15-10-2-1-5-20(18,19)8-10/h3-4,6,10,15H,1-2,5,7-8H2,(H,16,17).
What are the key properties of 4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid?
4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid has a molecular weight of 301.34 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1,1-dioxothian-3-yl)amino]methyl]-2-fluorobenzoic acid is sourced from PubChem (CID 106700058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).