C12H15ClFNO2S — CID 115762438
N-[(5-chloro-2-fluorophenyl)methyl]-1,1-dioxothian-3-amine (PubChem CID 115762438) has the molecular formula C12H15ClFNO2S and a molecular weight of 291.77 g/mol. Its IUPAC name is N-[(5-chloro-2-fluorophenyl)methyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[(5-chloro-2-fluorophenyl)methyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 115762438 |
| Molecular Formula | C12H15ClFNO2S |
| Molecular Weight | 291.77 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | N-[(5-chloro-2-fluorophenyl)methyl]-1,1-dioxothian-3-amine |
| SMILES | O=S1(=O)CCCC(NCc2cc(Cl)ccc2F)C1 |
| InChI | InChI=1S/C12H15ClFNO2S/c13-10-3-4-12(14)9(6-10)7-15-11-2-1-5-18(16,17)8-11/h3-4,6,11,15H,1-2,5,7-8H2 |
| InChIKey | AFIFSGMFUWJLCU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.77 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |