C10H14ClNO3S — CID 63922314
N-[(5-chlorofuran-2-yl)methyl]-1,1-dioxothian-3-amine (PubChem CID 63922314) has the molecular formula C10H14ClNO3S and a molecular weight of 263.75 g/mol. Its IUPAC name is N-[(5-chlorofuran-2-yl)methyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[(5-chlorofuran-2-yl)methyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63922314 |
| Molecular Formula | C10H14ClNO3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | N-[(5-chlorofuran-2-yl)methyl]-1,1-dioxothian-3-amine |
| SMILES | O=S1(=O)CCCC(NCc2ccc(Cl)o2)C1 |
| InChI | InChI=1S/C10H14ClNO3S/c11-10-4-3-9(15-10)6-12-8-2-1-5-16(13,14)7-8/h3-4,8,12H,1-2,5-7H2 |
| InChIKey | BODAKFZWLDVUBV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |