C13H17N3O2S — CID 66416465
1,1-dioxo-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)thian-3-amine (PubChem CID 66416465) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 1,1-dioxo-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)thian-3-amine.
| Compound Name | 1,1-dioxo-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)thian-3-amine |
|---|---|
| PubChem CID | 66416465 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1,1-dioxo-N-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)thian-3-amine |
| SMILES | O=S1(=O)CCCC(NCc2c[nH]c3ncccc23)C1 |
| InChI | InChI=1S/C13H17N3O2S/c17-19(18)6-2-3-11(9-19)15-7-10-8-16-13-12(10)4-1-5-14-13/h1,4-5,8,11,15H,2-3,6-7,9H2,(H,14,16) |
| InChIKey | NZMXTUMVAYJQNX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |