C17H17N3O2S — CID 23648920
4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 23648920) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 23648920 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | O=S(=O)(c1ccc(-c2ccnc3[nH]ccc23)cc1)N1CCCC1 |
| InChI | InChI=1S/C17H17N3O2S/c21-23(22,20-11-1-2-12-20)14-5-3-13(4-6-14)15-7-9-18-17-16(15)8-10-19-17/h3-10H,1-2,11-12H2,(H,18,19) |
| InChIKey | VJXSEEBNAAMNLS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |