C12H16ClNO3S — CID 63922713
2-chloro-4-[[(1,1-dioxothian-3-yl)amino]methyl]phenol (PubChem CID 63922713) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is 2-chloro-4-[[(1,1-dioxothian-3-yl)amino]methyl]phenol.
| Compound Name | 2-chloro-4-[[(1,1-dioxothian-3-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 63922713 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-chloro-4-[[(1,1-dioxothian-3-yl)amino]methyl]phenol |
| SMILES | O=S1(=O)CCCC(NCc2ccc(O)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H16ClNO3S/c13-11-6-9(3-4-12(11)15)7-14-10-2-1-5-18(16,17)8-10/h3-4,6,10,14-15H,1-2,5,7-8H2 |
| InChIKey | HQLVVQKRVIHOAG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |