C11H14ClNO2S — CID 40618468
(3S)-N-[(3-chlorophenyl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 40618468) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is (3S)-N-[(3-chlorophenyl)methyl]-1,1-dioxothiolan-3-amine.
| Compound Name | (3S)-N-[(3-chlorophenyl)methyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 40618468 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | (3S)-N-[(3-chlorophenyl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CC[C@H](NCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C11H14ClNO2S/c12-10-3-1-2-9(6-10)7-13-11-4-5-16(14,15)8-11/h1-3,6,11,13H,4-5,7-8H2/t11-/m0/s1 |
| InChIKey | HQVWWFTXVGIJNO-NSHDSACASA-N |
| XLogP | 1.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |