C13H17ClN2O3S — CID 110706175
1-[2-(3-chlorophenyl)ethyl]-3-(1,1-dioxothiolan-3-yl)urea (PubChem CID 110706175) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-(1,1-dioxothiolan-3-yl)urea.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-(1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 110706175 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-(1,1-dioxothiolan-3-yl)urea |
| SMILES | O=C(NCCc1cccc(Cl)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17ClN2O3S/c14-11-3-1-2-10(8-11)4-6-15-13(17)16-12-5-7-20(18,19)9-12/h1-3,8,12H,4-7,9H2,(H2,15,16,17) |
| InChIKey | WMQDUOABFWJFGS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |