C13H18N2O4S — CID 95310508
1-[(3R)-1,1-dioxothiolan-3-yl]-3-[2-(3-hydroxyphenyl)ethyl]urea (PubChem CID 95310508) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[2-(3-hydroxyphenyl)ethyl]urea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[2-(3-hydroxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 95310508 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[2-(3-hydroxyphenyl)ethyl]urea |
| SMILES | O=C(NCCc1cccc(O)c1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18N2O4S/c16-12-3-1-2-10(8-12)4-6-14-13(17)15-11-5-7-20(18,19)9-11/h1-3,8,11,16H,4-7,9H2,(H2,14,15,17)/t11-/m1/s1 |
| InChIKey | SIQYJBBWDDHYMB-LLVKDONJSA-N |
| XLogP | 0.42 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |