C16H30N4O6S2 — CID 51522467
1-[(3S)-1,1-dioxothiolan-3-yl]-3-[6-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]hexyl]urea (PubChem CID 51522467) has the molecular formula C16H30N4O6S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[6-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]hexyl]urea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[6-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]hexyl]urea |
|---|---|
| PubChem CID | 51522467 |
| Molecular Formula | C16H30N4O6S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[6-[[(3R)-1,1-dioxothiolan-3-yl]carbamoylamino]hexyl]urea |
| SMILES | O=C(NCCCCCCNC(=O)N[C@H]1CCS(=O)(=O)C1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H30N4O6S2/c21-15(19-13-5-9-27(23,24)11-13)17-7-3-1-2-4-8-18-16(22)20-14-6-10-28(25,26)12-14/h13-14H,1-12H2,(H2,17,19,21)(H2,18,20,22)/t13-,14+ |
| InChIKey | XQACUNXQDAWLME-OKILXGFUSA-N |
| XLogP | -0.48 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|