C7H11ClN2O4S — CID 7042972
2-chloro-N-[[(3S)-1,1-dioxothiolan-3-yl]carbamoyl]acetamide (PubChem CID 7042972) has the molecular formula C7H11ClN2O4S and a molecular weight of 254.69 g/mol. Its IUPAC name is 2-chloro-N-[[(3S)-1,1-dioxothiolan-3-yl]carbamoyl]acetamide.
| Compound Name | 2-chloro-N-[[(3S)-1,1-dioxothiolan-3-yl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 7042972 |
| Molecular Formula | C7H11ClN2O4S |
| Molecular Weight | 254.69 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 2-chloro-N-[[(3S)-1,1-dioxothiolan-3-yl]carbamoyl]acetamide |
| SMILES | O=C(CCl)NC(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H11ClN2O4S/c8-3-6(11)10-7(12)9-5-1-2-15(13,14)4-5/h5H,1-4H2,(H2,9,10,11,12)/t5-/m0/s1 |
| InChIKey | IDJVUDPXXRWYED-YFKPBYRVSA-N |
| XLogP | -0.76 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.69 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|