C10H16N2O6S — CID 63922384
4-[(1,1-dioxothian-3-yl)carbamoylamino]-4-oxobutanoic acid (PubChem CID 63922384) has the molecular formula C10H16N2O6S and a molecular weight of 292.31 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-3-yl)carbamoylamino]-4-oxobutanoic acid.
| Compound Name | 4-[(1,1-dioxothian-3-yl)carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63922384 |
| Molecular Formula | C10H16N2O6S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-[(1,1-dioxothian-3-yl)carbamoylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NC(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16N2O6S/c13-8(3-4-9(14)15)12-10(16)11-7-2-1-5-19(17,18)6-7/h7H,1-6H2,(H,14,15)(H2,11,12,13,16) |
| InChIKey | FONJNECWFCUDLL-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |