C14H25NO3S — CID 71994756
4-cyclopentyl-N-(1,1-dioxothian-3-yl)butanamide (PubChem CID 71994756) has the molecular formula C14H25NO3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 4-cyclopentyl-N-(1,1-dioxothian-3-yl)butanamide.
| Compound Name | 4-cyclopentyl-N-(1,1-dioxothian-3-yl)butanamide |
|---|---|
| PubChem CID | 71994756 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-cyclopentyl-N-(1,1-dioxothian-3-yl)butanamide |
| SMILES | O=C(CCCC1CCCC1)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H25NO3S/c16-14(9-3-7-12-5-1-2-6-12)15-13-8-4-10-19(17,18)11-13/h12-13H,1-11H2,(H,15,16) |
| InChIKey | NUKBUIFYCXMQCA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |