C9H16ClNO3S — CID 63923315
4-chloro-N-(1,1-dioxothian-3-yl)butanamide (PubChem CID 63923315) has the molecular formula C9H16ClNO3S and a molecular weight of 253.75 g/mol. Its IUPAC name is 4-chloro-N-(1,1-dioxothian-3-yl)butanamide.
| Compound Name | 4-chloro-N-(1,1-dioxothian-3-yl)butanamide |
|---|---|
| PubChem CID | 63923315 |
| Molecular Formula | C9H16ClNO3S |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 4-chloro-N-(1,1-dioxothian-3-yl)butanamide |
| SMILES | O=C(CCCCl)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16ClNO3S/c10-5-1-4-9(12)11-8-3-2-6-15(13,14)7-8/h8H,1-7H2,(H,11,12) |
| InChIKey | NQUTWSPEPDVUML-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|