C7H15ClN2O3S — CID 42943455
3-amino-N-(1,1-dioxothiolan-3-yl)propanamide;hydrochloride (PubChem CID 42943455) has the molecular formula C7H15ClN2O3S and a molecular weight of 242.73 g/mol. Its IUPAC name is 3-amino-N-(1,1-dioxothiolan-3-yl)propanamide;hydrochloride.
| Compound Name | 3-amino-N-(1,1-dioxothiolan-3-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 42943455 |
| Molecular Formula | C7H15ClN2O3S |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 3-amino-N-(1,1-dioxothiolan-3-yl)propanamide;hydrochloride |
| SMILES | Cl.NCCC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H14N2O3S.ClH/c8-3-1-7(10)9-6-2-4-13(11,12)5-6;/h6H,1-5,8H2,(H,9,10);1H |
| InChIKey | VMTAVJWTMULWEU-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |