C10H16N2O6S2 — CID 7102189
N,N'-bis[(3S)-1,1-dioxothiolan-3-yl]oxamide (PubChem CID 7102189) has the molecular formula C10H16N2O6S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N,N'-bis[(3S)-1,1-dioxothiolan-3-yl]oxamide.
| Compound Name | N,N'-bis[(3S)-1,1-dioxothiolan-3-yl]oxamide |
|---|---|
| PubChem CID | 7102189 |
| Molecular Formula | C10H16N2O6S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N,N'-bis[(3S)-1,1-dioxothiolan-3-yl]oxamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16N2O6S2/c13-9(11-7-1-3-19(15,16)5-7)10(14)12-8-2-4-20(17,18)6-8/h7-8H,1-6H2,(H,11,13)(H,12,14)/t7-,8-/m0/s1 |
| InChIKey | HVUDWKHJTKASIX-YUMQZZPRSA-N |
| XLogP | -2.41 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|