C10H15NO5S — CID 76991603
4-[(1,1-dioxothiolan-3-yl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76991603) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76991603 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15NO5S/c1-6(7(2)10(13)14)9(12)11-8-3-4-17(15,16)5-8/h8H,3-5H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | XPWXFZTYKMRDAL-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|