C9H16N2O5S2 — CID 2831152
1,3-bis(1,1-dioxothiolan-3-yl)urea (PubChem CID 2831152) has the molecular formula C9H16N2O5S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1,3-bis(1,1-dioxothiolan-3-yl)urea.
| Compound Name | 1,3-bis(1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 2831152 |
| Molecular Formula | C9H16N2O5S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1,3-bis(1,1-dioxothiolan-3-yl)urea |
| SMILES | O=C(NC1CCS(=O)(=O)C1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16N2O5S2/c12-9(10-7-1-3-17(13,14)5-7)11-8-2-4-18(15,16)6-8/h7-8H,1-6H2,(H2,10,11,12) |
| InChIKey | DMOBVAOZXXFKDA-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |