C10H19N3O3S — CID 129409749
1-[(3R)-1,1-dioxothiolan-3-yl]-3-piperidin-4-ylurea (PubChem CID 129409749) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-piperidin-4-ylurea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-piperidin-4-ylurea |
|---|---|
| PubChem CID | 129409749 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-piperidin-4-ylurea |
| SMILES | O=C(NC1CCNCC1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19N3O3S/c14-10(12-8-1-4-11-5-2-8)13-9-3-6-17(15,16)7-9/h8-9,11H,1-7H2,(H2,12,13,14)/t9-/m1/s1 |
| InChIKey | AUCHOQKBYFHCAI-SECBINFHSA-N |
| XLogP | -0.78 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |