C6H11NO3S — CID 7114858
N-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 7114858) has the molecular formula C6H11NO3S and a molecular weight of 177.22 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 7114858 |
| Molecular Formula | C6H11NO3S |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H11NO3S/c1-5(8)7-6-2-3-11(9,10)4-6/h6H,2-4H2,1H3,(H,7,8)/t6-/m0/s1 |
| InChIKey | ZCJFCJXAGKPMHF-LURJTMIESA-N |
| XLogP | -0.69 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |