methyl N-(1,1-dioxothiolan-3-yl)carbamate

C6H11NO4S — CID 2999519

IUPACmethyl N-(1,1-dioxothiolan-3-yl)carbamate
SMILESCOC(=O)NC1CCS(=O)(=O)C1
InChIInChI=1S/C6H11NO4S/c1-11-6(8)7-5-2-3-12(9,10)4-5/h5H,2-4H2,1H3,(H,7,8)
InChIKeyLNBQVPKVAVZEFD-UHFFFAOYSA-N
MW193.22 g/mol
LogP-0.47
Rot. Bonds1

About methyl N-(1,1-dioxothiolan-3-yl)carbamate

methyl N-(1,1-dioxothiolan-3-yl)carbamate (PubChem CID 2999519) has the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. Its IUPAC name is methyl N-(1,1-dioxothiolan-3-yl)carbamate.

Molecular Properties

Compound Namemethyl N-(1,1-dioxothiolan-3-yl)carbamate
PubChem CID2999519
Molecular FormulaC6H11NO4S
Molecular Weight193.22 g/mol
Exact Mass193.04
IUPAC Namemethyl N-(1,1-dioxothiolan-3-yl)carbamate
SMILESCOC(=O)NC1CCS(=O)(=O)C1
InChIInChI=1S/C6H11NO4S/c1-11-6(8)7-5-2-3-12(9,10)4-5/h5H,2-4H2,1H3,(H,7,8)
InChIKeyLNBQVPKVAVZEFD-UHFFFAOYSA-N
XLogP-0.47
TPSA72.47 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.22
LogP ≤ 5-0.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl N-(1,1-dioxothiolan-3-yl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-(1,1-dioxothiolan-3-yl)carbamate?
The IUPAC name of methyl N-(1,1-dioxothiolan-3-yl)carbamate (CID 2999519) is methyl N-(1,1-dioxothiolan-3-yl)carbamate.
What is the SMILES notation for methyl N-(1,1-dioxothiolan-3-yl)carbamate?
The canonical SMILES for methyl N-(1,1-dioxothiolan-3-yl)carbamate is COC(=O)NC1CCS(=O)(=O)C1.
What is the InChIKey of methyl N-(1,1-dioxothiolan-3-yl)carbamate?
The InChIKey is LNBQVPKVAVZEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4S/c1-11-6(8)7-5-2-3-12(9,10)4-5/h5H,2-4H2,1H3,(H,7,8).
What are the key properties of methyl N-(1,1-dioxothiolan-3-yl)carbamate?
methyl N-(1,1-dioxothiolan-3-yl)carbamate has a molecular weight of 193.22 g/mol, XLogP of -0.47, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(1,1-dioxothiolan-3-yl)carbamate is sourced from PubChem (CID 2999519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).