C7H11Br2NO4S — CID 94854090
2,2-dibromoethyl N-[(3S)-1,1-dioxothiolan-3-yl]carbamate (PubChem CID 94854090) has the molecular formula C7H11Br2NO4S and a molecular weight of 365.04 g/mol. Its IUPAC name is 2,2-dibromoethyl N-[(3S)-1,1-dioxothiolan-3-yl]carbamate.
| Compound Name | 2,2-dibromoethyl N-[(3S)-1,1-dioxothiolan-3-yl]carbamate |
|---|---|
| PubChem CID | 94854090 |
| Molecular Formula | C7H11Br2NO4S |
| Molecular Weight | 365.04 g/mol |
| Exact Mass | 362.88 |
| IUPAC Name | 2,2-dibromoethyl N-[(3S)-1,1-dioxothiolan-3-yl]carbamate |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)OCC(Br)Br |
| InChI | InChI=1S/C7H11Br2NO4S/c8-6(9)3-14-7(11)10-5-1-2-15(12,13)4-5/h5-6H,1-4H2,(H,10,11)/t5-/m0/s1 |
| InChIKey | JHJULAMHFNTBMM-YFKPBYRVSA-N |
| XLogP | 1.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.04 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|