C8H13Cl2NO3S2 — CID 94854128
O-[(2R)-2,3-dichloropropyl] N-[(3S)-1,1-dioxothiolan-3-yl]carbamothioate (PubChem CID 94854128) has the molecular formula C8H13Cl2NO3S2 and a molecular weight of 306.24 g/mol. Its IUPAC name is O-[(2R)-2,3-dichloropropyl] N-[(3S)-1,1-dioxothiolan-3-yl]carbamothioate.
| Compound Name | O-[(2R)-2,3-dichloropropyl] N-[(3S)-1,1-dioxothiolan-3-yl]carbamothioate |
|---|---|
| PubChem CID | 94854128 |
| Molecular Formula | C8H13Cl2NO3S2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | O-[(2R)-2,3-dichloropropyl] N-[(3S)-1,1-dioxothiolan-3-yl]carbamothioate |
| SMILES | O=S1(=O)CC[C@H](NC(=S)OC[C@@H](Cl)CCl)C1 |
| InChI | InChI=1S/C8H13Cl2NO3S2/c9-3-6(10)4-14-8(15)11-7-1-2-16(12,13)5-7/h6-7H,1-5H2,(H,11,15)/t6-,7-/m0/s1 |
| InChIKey | LYFCOUTYNAFKFH-BQBZGAKWSA-N |
| XLogP | 0.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|