C11H21NO3S2 — CID 43827824
O-(4-methylpentyl) N-(1,1-dioxothiolan-3-yl)carbamothioate (PubChem CID 43827824) has the molecular formula C11H21NO3S2 and a molecular weight of 279.43 g/mol. Its IUPAC name is O-(4-methylpentyl) N-(1,1-dioxothiolan-3-yl)carbamothioate.
| Compound Name | O-(4-methylpentyl) N-(1,1-dioxothiolan-3-yl)carbamothioate |
|---|---|
| PubChem CID | 43827824 |
| Molecular Formula | C11H21NO3S2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | O-(4-methylpentyl) N-(1,1-dioxothiolan-3-yl)carbamothioate |
| SMILES | CC(C)CCCOC(=S)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H21NO3S2/c1-9(2)4-3-6-15-11(16)12-10-5-7-17(13,14)8-10/h9-10H,3-8H2,1-2H3,(H,12,16) |
| InChIKey | RYBFLLNRCIMTLG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|