C8H15NO2S3 — CID 40500494
propan-2-yl N-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioate (PubChem CID 40500494) has the molecular formula C8H15NO2S3 and a molecular weight of 253.41 g/mol. Its IUPAC name is propan-2-yl N-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioate.
| Compound Name | propan-2-yl N-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioate |
|---|---|
| PubChem CID | 40500494 |
| Molecular Formula | C8H15NO2S3 |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | propan-2-yl N-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioate |
| SMILES | CC(C)SC(=S)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO2S3/c1-6(2)13-8(12)9-7-3-4-14(10,11)5-7/h6-7H,3-5H2,1-2H3,(H,9,12)/t7-/m1/s1 |
| InChIKey | MXPDQAHTHLGMCH-SSDOTTSWSA-N |
| XLogP | 1.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|