C10H18N2O3S3 — CID 9373280
[(2R)-1-[[(3S)-1,1-dioxothiolan-3-yl]amino]-1-oxopropan-2-yl] N,N-dimethylcarbamodithioate (PubChem CID 9373280) has the molecular formula C10H18N2O3S3 and a molecular weight of 310.47 g/mol. Its IUPAC name is [(2R)-1-[[(3S)-1,1-dioxothiolan-3-yl]amino]-1-oxopropan-2-yl] N,N-dimethylcarbamodithioate.
| Compound Name | [(2R)-1-[[(3S)-1,1-dioxothiolan-3-yl]amino]-1-oxopropan-2-yl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 9373280 |
| Molecular Formula | C10H18N2O3S3 |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | [(2R)-1-[[(3S)-1,1-dioxothiolan-3-yl]amino]-1-oxopropan-2-yl] N,N-dimethylcarbamodithioate |
| SMILES | C[C@@H](SC(=S)N(C)C)C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N2O3S3/c1-7(17-10(16)12(2)3)9(13)11-8-4-5-18(14,15)6-8/h7-8H,4-6H2,1-3H3,(H,11,13)/t7-,8+/m1/s1 |
| InChIKey | AKHMCHXPQBBHIK-SFYZADRCSA-N |
| XLogP | 0.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|