C9H17NO3S2 — CID 47135984
N-(1,1-dioxothiolan-3-yl)-2-ethylsulfanylpropanamide (PubChem CID 47135984) has the molecular formula C9H17NO3S2 and a molecular weight of 251.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-ethylsulfanylpropanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-ethylsulfanylpropanamide |
|---|---|
| PubChem CID | 47135984 |
| Molecular Formula | C9H17NO3S2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-ethylsulfanylpropanamide |
| SMILES | CCSC(C)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO3S2/c1-3-14-7(2)9(11)10-8-4-5-15(12,13)6-8/h7-8H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | UWZWVCFVZZIFIU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |