C16H23NO4S2 — CID 26633008
(2R)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-[2-(3-methylphenoxy)ethylsulfanyl]propanamide (PubChem CID 26633008) has the molecular formula C16H23NO4S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is (2R)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-[2-(3-methylphenoxy)ethylsulfanyl]propanamide.
| Compound Name | (2R)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-[2-(3-methylphenoxy)ethylsulfanyl]propanamide |
|---|---|
| PubChem CID | 26633008 |
| Molecular Formula | C16H23NO4S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | (2R)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-[2-(3-methylphenoxy)ethylsulfanyl]propanamide |
| SMILES | Cc1cccc(OCCS[C@H](C)C(=O)N[C@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C16H23NO4S2/c1-12-4-3-5-15(10-12)21-7-8-22-13(2)16(18)17-14-6-9-23(19,20)11-14/h3-5,10,13-14H,6-9,11H2,1-2H3,(H,17,18)/t13-,14+/m1/s1 |
| InChIKey | QVOKEQSLEPUDCU-KGLIPLIRSA-N |
| XLogP | 1.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|