C14H18FNO4S2 — CID 95333812
N-[(3S)-1,1-dioxothiolan-3-yl]-2-[2-(3-fluorophenoxy)ethylsulfanyl]acetamide (PubChem CID 95333812) has the molecular formula C14H18FNO4S2 and a molecular weight of 347.43 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-[2-(3-fluorophenoxy)ethylsulfanyl]acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[2-(3-fluorophenoxy)ethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 95333812 |
| Molecular Formula | C14H18FNO4S2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[2-(3-fluorophenoxy)ethylsulfanyl]acetamide |
| SMILES | O=C(CSCCOc1cccc(F)c1)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H18FNO4S2/c15-11-2-1-3-13(8-11)20-5-6-21-9-14(17)16-12-4-7-22(18,19)10-12/h1-3,8,12H,4-7,9-10H2,(H,16,17)/t12-/m0/s1 |
| InChIKey | FWIFITOTYAUQMI-LBPRGKRZSA-N |
| XLogP | 1.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|