C13H17NO5S — CID 7090744
N-[(3R)-1,1-dioxothiolan-3-yl]-2-(3-methoxyphenoxy)acetamide (PubChem CID 7090744) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-(3-methoxyphenoxy)acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(3-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 7090744 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(3-methoxyphenoxy)acetamide |
| SMILES | COc1cccc(OCC(=O)N[C@@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H17NO5S/c1-18-11-3-2-4-12(7-11)19-8-13(15)14-10-5-6-20(16,17)9-10/h2-4,7,10H,5-6,8-9H2,1H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | JAWPTPACGBCICF-SNVBAGLBSA-N |
| XLogP | 0.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |