C18H27NO5S — CID 4733336
N-(1,1-dioxothiolan-3-yl)-2-(3-hexoxyphenoxy)acetamide (PubChem CID 4733336) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(3-hexoxyphenoxy)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(3-hexoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 4733336 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(3-hexoxyphenoxy)acetamide |
| SMILES | CCCCCCOc1cccc(OCC(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C18H27NO5S/c1-2-3-4-5-10-23-16-7-6-8-17(12-16)24-13-18(20)19-15-9-11-25(21,22)14-15/h6-8,12,15H,2-5,9-11,13-14H2,1H3,(H,19,20) |
| InChIKey | SYDYEDTVLFCKKB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|