C14H18N2O5S — CID 18870054
2-(3-acetamidophenoxy)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 18870054) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 2-(3-acetamidophenoxy)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(3-acetamidophenoxy)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 18870054 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-(3-acetamidophenoxy)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CC(=O)Nc1cccc(OCC(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H18N2O5S/c1-10(17)15-11-3-2-4-13(7-11)21-8-14(18)16-12-5-6-22(19,20)9-12/h2-4,7,12H,5-6,8-9H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | UFTWWAGQQATZQJ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |