C18H20N2O4S — CID 27710023
2-(4-anilinophenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 27710023) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-(4-anilinophenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(4-anilinophenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 27710023 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-(4-anilinophenoxy)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(COc1ccc(Nc2ccccc2)cc1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H20N2O4S/c21-18(20-16-10-11-25(22,23)13-16)12-24-17-8-6-15(7-9-17)19-14-4-2-1-3-5-14/h1-9,16,19H,10-13H2,(H,20,21)/t16-/m1/s1 |
| InChIKey | KEURPRLNYYMPAX-MRXNPFEDSA-N |
| XLogP | 2.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |