C19H21NO5S — CID 6601801
N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-phenylmethoxyphenoxy)acetamide (PubChem CID 6601801) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-phenylmethoxyphenoxy)acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-phenylmethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 6601801 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-phenylmethoxyphenoxy)acetamide |
| SMILES | O=C(COc1ccc(OCc2ccccc2)cc1)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21NO5S/c21-19(20-16-10-11-26(22,23)14-16)13-25-18-8-6-17(7-9-18)24-12-15-4-2-1-3-5-15/h1-9,16H,10-14H2,(H,20,21)/t16-/m0/s1 |
| InChIKey | LWDDJCDATYSKPX-INIZCTEOSA-N |
| XLogP | 1.95 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |