C14H17NO6S — CID 7667372
methyl 4-[2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethoxy]benzoate (PubChem CID 7667372) has the molecular formula C14H17NO6S and a molecular weight of 327.36 g/mol. Its IUPAC name is methyl 4-[2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethoxy]benzoate.
| Compound Name | methyl 4-[2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 7667372 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | methyl 4-[2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)N[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H17NO6S/c1-20-14(17)10-2-4-12(5-3-10)21-8-13(16)15-11-6-7-22(18,19)9-11/h2-5,11H,6-9H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | UDSSJQQDKFWZIE-NSHDSACASA-N |
| XLogP | 0.16 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |