C17H19NO7S — CID 3881341
methyl 4-[3-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 3881341) has the molecular formula C17H19NO7S and a molecular weight of 381.41 g/mol. Its IUPAC name is methyl 4-[3-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[3-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 3881341 |
| Molecular Formula | C17H19NO7S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | methyl 4-[3-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(C=CC(=O)OCC(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H19NO7S/c1-24-17(21)13-5-2-12(3-6-13)4-7-16(20)25-10-15(19)18-14-8-9-26(22,23)11-14/h2-7,14H,8-11H2,1H3,(H,18,19) |
| InChIKey | FJPRUOLRIYRCKJ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|