C16H17F2NO6S — CID 42902667
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 42902667) has the molecular formula C16H17F2NO6S and a molecular weight of 389.38 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 42902667 |
| Molecular Formula | C16H17F2NO6S |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(OC(F)F)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H17F2NO6S/c17-16(18)25-13-4-1-11(2-5-13)3-6-15(21)24-9-14(20)19-12-7-8-26(22,23)10-12/h1-6,12,16H,7-10H2,(H,19,20)/b6-3+ |
| InChIKey | MFYWTPUAUBYDRJ-ZZXKWVIFSA-N |
| XLogP | 1.15 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|