C15H16FNO5S — CID 6213301
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 6213301) has the molecular formula C15H16FNO5S and a molecular weight of 341.36 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6213301 |
| Molecular Formula | C15H16FNO5S |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc(F)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H16FNO5S/c16-12-3-1-2-11(8-12)4-5-15(19)22-9-14(18)17-13-6-7-23(20,21)10-13/h1-5,8,13H,6-7,9-10H2,(H,17,18)/b5-4+ |
| InChIKey | SNJRFYCSFMYUEA-SNAWJCMRSA-N |
| XLogP | 0.69 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|