C19H26N2O7S2 — CID 41144436
[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 41144436) has the molecular formula C19H26N2O7S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 41144436 |
| Molecular Formula | C19H26N2O7S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)OCC(=O)N[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C19H26N2O7S2/c1-3-21(4-2)30(26,27)17-8-5-15(6-9-17)7-10-19(23)28-13-18(22)20-16-11-12-29(24,25)14-16/h5-10,16H,3-4,11-14H2,1-2H3,(H,20,22)/b10-7+/t16-/m1/s1 |
| InChIKey | JZRRCPXDFRGEFJ-OJXHRBAXSA-N |
| XLogP | 0.58 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|