C17H21F3N2O5S — CID 2578921
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 2578921) has the molecular formula C17H21F3N2O5S and a molecular weight of 422.43 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2578921 |
| Molecular Formula | C17H21F3N2O5S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)OCC(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H21F3N2O5S/c1-3-22(4-2)28(25,26)14-8-5-13(6-9-14)7-10-16(24)27-11-15(23)21-12-17(18,19)20/h5-10H,3-4,11-12H2,1-2H3,(H,21,23)/b10-7+ |
| InChIKey | YVFPPIDBGRFRDX-JXMROGBWSA-N |
| XLogP | 1.95 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|