C23H27NO6S — CID 31114886
[2-(4-ethoxyphenyl)-2-oxoethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 31114886) has the molecular formula C23H27NO6S and a molecular weight of 445.54 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 31114886 |
| Molecular Formula | C23H27NO6S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)/C=C/c2ccc(S(=O)(=O)N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C23H27NO6S/c1-4-24(5-2)31(27,28)21-14-7-18(8-15-21)9-16-23(26)30-17-22(25)19-10-12-20(13-11-19)29-6-3/h7-16H,4-6,17H2,1-3H3/b16-9+ |
| InChIKey | UUXPVKGJWUPKHJ-CXUHLZMHSA-N |
| XLogP | 3.56 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|