C23H28N2O7S — CID 41383228
methyl 5-[2-[(E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoyl]oxyacetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 41383228) has the molecular formula C23H28N2O7S and a molecular weight of 476.55 g/mol. Its IUPAC name is methyl 5-[2-[(E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoyl]oxyacetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[2-[(E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoyl]oxyacetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 41383228 |
| Molecular Formula | C23H28N2O7S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | methyl 5-[2-[(E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoyl]oxyacetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)OCC(=O)c2[nH]c(C)c(C(=O)OC)c2C)cc1 |
| InChI | InChI=1S/C23H28N2O7S/c1-6-25(7-2)33(29,30)18-11-8-17(9-12-18)10-13-20(27)32-14-19(26)22-15(3)21(16(4)24-22)23(28)31-5/h8-13,24H,6-7,14H2,1-5H3/b13-10+ |
| InChIKey | FOGLFGJLZHRQET-JLHYYAGUSA-N |
| XLogP | 2.89 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|