C22H24N2O6S — CID 55315296
(2-benzamido-2-oxoethyl) (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 55315296) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | (2-benzamido-2-oxoethyl) (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55315296 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (2-benzamido-2-oxoethyl) (E)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)OCC(=O)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N2O6S/c1-3-24(4-2)31(28,29)19-13-10-17(11-14-19)12-15-21(26)30-16-20(25)23-22(27)18-8-6-5-7-9-18/h5-15H,3-4,16H2,1-2H3,(H,23,25,27)/b15-12+ |
| InChIKey | OLFVAZOZZHLAOG-NTCAYCPXSA-N |
| XLogP | 2.23 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|