C20H20FNO5 — CID 4207086
ethyl 5-[2-[3-(3-fluorophenyl)prop-2-enoyloxy]acetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 4207086) has the molecular formula C20H20FNO5 and a molecular weight of 373.38 g/mol. Its IUPAC name is ethyl 5-[2-[3-(3-fluorophenyl)prop-2-enoyloxy]acetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[2-[3-(3-fluorophenyl)prop-2-enoyloxy]acetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4207086 |
| Molecular Formula | C20H20FNO5 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | ethyl 5-[2-[3-(3-fluorophenyl)prop-2-enoyloxy]acetyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)COC(=O)C=Cc2cccc(F)c2)c1C |
| InChI | InChI=1S/C20H20FNO5/c1-4-26-20(25)18-12(2)19(22-13(18)3)16(23)11-27-17(24)9-8-14-6-5-7-15(21)10-14/h5-10,22H,4,11H2,1-3H3 |
| InChIKey | CWUKJVCCZMDYMQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|