C21H22FNO5S — CID 7786042
ethyl 5-ethyl-2-[[2-[(E)-3-(3-fluorophenyl)prop-2-enoyl]oxyacetyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 7786042) has the molecular formula C21H22FNO5S and a molecular weight of 419.47 g/mol. Its IUPAC name is ethyl 5-ethyl-2-[[2-[(E)-3-(3-fluorophenyl)prop-2-enoyl]oxyacetyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-2-[[2-[(E)-3-(3-fluorophenyl)prop-2-enoyl]oxyacetyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7786042 |
| Molecular Formula | C21H22FNO5S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | ethyl 5-ethyl-2-[[2-[(E)-3-(3-fluorophenyl)prop-2-enoyl]oxyacetyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)/C=C/c2cccc(F)c2)sc(CC)c1C |
| InChI | InChI=1S/C21H22FNO5S/c1-4-16-13(3)19(21(26)27-5-2)20(29-16)23-17(24)12-28-18(25)10-9-14-7-6-8-15(22)11-14/h6-11H,4-5,12H2,1-3H3,(H,23,24)/b10-9+ |
| InChIKey | UIYZJCGOSHHTTG-MDZDMXLPSA-N |
| XLogP | 4.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|