C20H20FNO5S — CID 7767187
ethyl 5-ethyl-2-[[2-[(E)-3-(4-fluorophenyl)prop-2-enoyl]oxyacetyl]amino]thiophene-3-carboxylate (PubChem CID 7767187) has the molecular formula C20H20FNO5S and a molecular weight of 405.45 g/mol. Its IUPAC name is ethyl 5-ethyl-2-[[2-[(E)-3-(4-fluorophenyl)prop-2-enoyl]oxyacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-2-[[2-[(E)-3-(4-fluorophenyl)prop-2-enoyl]oxyacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 7767187 |
| Molecular Formula | C20H20FNO5S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | ethyl 5-ethyl-2-[[2-[(E)-3-(4-fluorophenyl)prop-2-enoyl]oxyacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)COC(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FNO5S/c1-3-15-11-16(20(25)26-4-2)19(28-15)22-17(23)12-27-18(24)10-7-13-5-8-14(21)9-6-13/h5-11H,3-4,12H2,1-2H3,(H,22,23)/b10-7+ |
| InChIKey | LIOPOIFDYSIFFC-JXMROGBWSA-N |
| XLogP | 3.82 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|